C12H8ClFO3S — CID 103046291
4-[(5-chloro-2-fluorophenyl)methoxy]thiophene-2-carboxylic acid (PubChem CID 103046291) has the molecular formula C12H8ClFO3S and a molecular weight of 286.71 g/mol. Its IUPAC name is 4-[(5-chloro-2-fluorophenyl)methoxy]thiophene-2-carboxylic acid.
| Compound Name | 4-[(5-chloro-2-fluorophenyl)methoxy]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 103046291 |
| Molecular Formula | C12H8ClFO3S |
| Molecular Weight | 286.71 g/mol |
| Exact Mass | 285.99 |
| IUPAC Name | 4-[(5-chloro-2-fluorophenyl)methoxy]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(OCc2cc(Cl)ccc2F)cs1 |
| InChI | InChI=1S/C12H8ClFO3S/c13-8-1-2-10(14)7(3-8)5-17-9-4-11(12(15)16)18-6-9/h1-4,6H,5H2,(H,15,16) |
| InChIKey | HUQZQBOFGCBIAX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |