C12H9ClO3S — CID 19620576
4-[(4-chlorophenoxy)methyl]thiophene-2-carboxylic acid (PubChem CID 19620576) has the molecular formula C12H9ClO3S and a molecular weight of 268.72 g/mol. Its IUPAC name is 4-[(4-chlorophenoxy)methyl]thiophene-2-carboxylic acid.
| Compound Name | 4-[(4-chlorophenoxy)methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 19620576 |
| Molecular Formula | C12H9ClO3S |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 4-[(4-chlorophenoxy)methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1cc(COc2ccc(Cl)cc2)cs1 |
| InChI | InChI=1S/C12H9ClO3S/c13-9-1-3-10(4-2-9)16-6-8-5-11(12(14)15)17-7-8/h1-5,7H,6H2,(H,14,15) |
| InChIKey | SAJHXNAWZOTDHR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |