C22H21ClN2O4S2 — CID 19503455
[4-(benzenesulfonyl)piperazin-1-yl]-[4-[(4-chlorophenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 19503455) has the molecular formula C22H21ClN2O4S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-[4-[(4-chlorophenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-[4-[(4-chlorophenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19503455 |
| Molecular Formula | C22H21ClN2O4S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-[4-[(4-chlorophenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(COc2ccc(Cl)cc2)cs1)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H21ClN2O4S2/c23-18-6-8-19(9-7-18)29-15-17-14-21(30-16-17)22(26)24-10-12-25(13-11-24)31(27,28)20-4-2-1-3-5-20/h1-9,14,16H,10-13,15H2 |
| InChIKey | NOLJSMOGUWZRCV-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |