C23H24N2O2S — CID 19490824
(4-benzylpiperazin-1-yl)-[4-(phenoxymethyl)thiophen-2-yl]methanone (PubChem CID 19490824) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[4-(phenoxymethyl)thiophen-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[4-(phenoxymethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19490824 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[4-(phenoxymethyl)thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(COc2ccccc2)cs1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H24N2O2S/c26-23(22-15-20(18-28-22)17-27-21-9-5-2-6-10-21)25-13-11-24(12-14-25)16-19-7-3-1-4-8-19/h1-10,15,18H,11-14,16-17H2 |
| InChIKey | ZDASKNRMDPPWBX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |