C24H25ClN2O2S — CID 19488767
(4-benzylpiperazin-1-yl)-[4-[(2-chloro-5-methylphenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 19488767) has the molecular formula C24H25ClN2O2S and a molecular weight of 441.00 g/mol. Its IUPAC name is (4-benzylpiperazin-1-yl)-[4-[(2-chloro-5-methylphenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | (4-benzylpiperazin-1-yl)-[4-[(2-chloro-5-methylphenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19488767 |
| Molecular Formula | C24H25ClN2O2S |
| Molecular Weight | 441.00 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (4-benzylpiperazin-1-yl)-[4-[(2-chloro-5-methylphenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | Cc1ccc(Cl)c(OCc2csc(C(=O)N3CCN(Cc4ccccc4)CC3)c2)c1 |
| InChI | InChI=1S/C24H25ClN2O2S/c1-18-7-8-21(25)22(13-18)29-16-20-14-23(30-17-20)24(28)27-11-9-26(10-12-27)15-19-5-3-2-4-6-19/h2-8,13-14,17H,9-12,15-16H2,1H3 |
| InChIKey | PQUDERHSHLJOMI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.00 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |