C23H23FN2O2S — CID 19490964
[4-[(2-fluorophenyl)methyl]piperazin-1-yl]-[4-(phenoxymethyl)thiophen-2-yl]methanone (PubChem CID 19490964) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is [4-[(2-fluorophenyl)methyl]piperazin-1-yl]-[4-(phenoxymethyl)thiophen-2-yl]methanone.
| Compound Name | [4-[(2-fluorophenyl)methyl]piperazin-1-yl]-[4-(phenoxymethyl)thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19490964 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [4-[(2-fluorophenyl)methyl]piperazin-1-yl]-[4-(phenoxymethyl)thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(COc2ccccc2)cs1)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C23H23FN2O2S/c24-21-9-5-4-6-19(21)15-25-10-12-26(13-11-25)23(27)22-14-18(17-29-22)16-28-20-7-2-1-3-8-20/h1-9,14,17H,10-13,15-16H2 |
| InChIKey | RUUOPULUPXMUTD-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |