C27H31NO2S — CID 19484538
(4-benzylpiperidin-1-yl)-[4-[(4-propan-2-ylphenoxy)methyl]thiophen-2-yl]methanone (PubChem CID 19484538) has the molecular formula C27H31NO2S and a molecular weight of 433.62 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[4-[(4-propan-2-ylphenoxy)methyl]thiophen-2-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[4-[(4-propan-2-ylphenoxy)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19484538 |
| Molecular Formula | C27H31NO2S |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[4-[(4-propan-2-ylphenoxy)methyl]thiophen-2-yl]methanone |
| SMILES | CC(C)c1ccc(OCc2csc(C(=O)N3CCC(Cc4ccccc4)CC3)c2)cc1 |
| InChI | InChI=1S/C27H31NO2S/c1-20(2)24-8-10-25(11-9-24)30-18-23-17-26(31-19-23)27(29)28-14-12-22(13-15-28)16-21-6-4-3-5-7-21/h3-11,17,19-20,22H,12-16,18H2,1-2H3 |
| InChIKey | WXRMGVZXEDOKRY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |