C24H25NO4S — CID 19498976
ethyl 1-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperidine-4-carboxylate (PubChem CID 19498976) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is ethyl 1-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 19498976 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | ethyl 1-[4-(naphthalen-2-yloxymethyl)thiophene-2-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(COc3ccc4ccccc4c3)cs2)CC1 |
| InChI | InChI=1S/C24H25NO4S/c1-2-28-24(27)19-9-11-25(12-10-19)23(26)22-13-17(16-30-22)15-29-21-8-7-18-5-3-4-6-20(18)14-21/h3-8,13-14,16,19H,2,9-12,15H2,1H3 |
| InChIKey | BMAMGYYYZMUROE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |