C22H24FNO4 — CID 51110016
ethyl 1-[3-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate (PubChem CID 51110016) has the molecular formula C22H24FNO4 and a molecular weight of 385.44 g/mol. Its IUPAC name is ethyl 1-[3-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 51110016 |
| Molecular Formula | C22H24FNO4 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.17 |
| IUPAC Name | ethyl 1-[3-[(4-fluorophenyl)methoxy]benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccc(OCc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C22H24FNO4/c1-2-27-22(26)17-10-12-24(13-11-17)21(25)18-4-3-5-20(14-18)28-15-16-6-8-19(23)9-7-16/h3-9,14,17H,2,10-13,15H2,1H3 |
| InChIKey | UNBNSHJCHNPQML-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |