C21H25FN2O4S — CID 56572417
[3-[(4-fluorophenyl)methoxy]phenyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone (PubChem CID 56572417) has the molecular formula C21H25FN2O4S and a molecular weight of 420.51 g/mol. Its IUPAC name is [3-[(4-fluorophenyl)methoxy]phenyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone.
| Compound Name | [3-[(4-fluorophenyl)methoxy]phenyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 56572417 |
| Molecular Formula | C21H25FN2O4S |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | [3-[(4-fluorophenyl)methoxy]phenyl]-[4-(2-methylsulfonylethyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)CCN1CCN(C(=O)c2cccc(OCc3ccc(F)cc3)c2)CC1 |
| InChI | InChI=1S/C21H25FN2O4S/c1-29(26,27)14-13-23-9-11-24(12-10-23)21(25)18-3-2-4-20(15-18)28-16-17-5-7-19(22)8-6-17/h2-8,15H,9-14,16H2,1H3 |
| InChIKey | ZCWHXGOCFNLQFJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |