C21H24N2O4 — CID 47069831
ethyl 1-(2-phenylmethoxypyridine-4-carbonyl)piperidine-4-carboxylate (PubChem CID 47069831) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is ethyl 1-(2-phenylmethoxypyridine-4-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(2-phenylmethoxypyridine-4-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 47069831 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | ethyl 1-(2-phenylmethoxypyridine-4-carbonyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2ccnc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C21H24N2O4/c1-2-26-21(25)17-9-12-23(13-10-17)20(24)18-8-11-22-19(14-18)27-15-16-6-4-3-5-7-16/h3-8,11,14,17H,2,9-10,12-13,15H2,1H3 |
| InChIKey | RYQQILMUFDHGDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |