C20H23N3O4 — CID 121167757
ethyl 1-(6-phenylmethoxypyrimidine-4-carbonyl)piperidine-3-carboxylate (PubChem CID 121167757) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is ethyl 1-(6-phenylmethoxypyrimidine-4-carbonyl)piperidine-3-carboxylate.
| Compound Name | ethyl 1-(6-phenylmethoxypyrimidine-4-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 121167757 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | ethyl 1-(6-phenylmethoxypyrimidine-4-carbonyl)piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cc(OCc3ccccc3)ncn2)C1 |
| InChI | InChI=1S/C20H23N3O4/c1-2-26-20(25)16-9-6-10-23(12-16)19(24)17-11-18(22-14-21-17)27-13-15-7-4-3-5-8-15/h3-5,7-8,11,14,16H,2,6,9-10,12-13H2,1H3 |
| InChIKey | AOFSQIVGUNZTAD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 81.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |