C16H20ClNO3 — CID 43156402
ethyl 1-[3-(chloromethyl)benzoyl]piperidine-4-carboxylate (PubChem CID 43156402) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is ethyl 1-[3-(chloromethyl)benzoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[3-(chloromethyl)benzoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 43156402 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | ethyl 1-[3-(chloromethyl)benzoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cccc(CCl)c2)CC1 |
| InChI | InChI=1S/C16H20ClNO3/c1-2-21-16(20)13-6-8-18(9-7-13)15(19)14-5-3-4-12(10-14)11-17/h3-5,10,13H,2,6-9,11H2,1H3 |
| InChIKey | DYAVRDPDQDXOIJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|