C22H27NO4 — CID 30392998
ethyl 1-[(2R)-2-naphthalen-2-yloxybutanoyl]piperidine-4-carboxylate (PubChem CID 30392998) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl 1-[(2R)-2-naphthalen-2-yloxybutanoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2R)-2-naphthalen-2-yloxybutanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 30392998 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethyl 1-[(2R)-2-naphthalen-2-yloxybutanoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)[C@@H](CC)Oc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C22H27NO4/c1-3-20(27-19-10-9-16-7-5-6-8-18(16)15-19)21(24)23-13-11-17(12-14-23)22(25)26-4-2/h5-10,15,17,20H,3-4,11-14H2,1-2H3/t20-/m1/s1 |
| InChIKey | BMLABELLLLOCQB-HXUWFJFHSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |