C18H25NO5 — CID 46763822
methyl 1-[2-(3-methoxyphenoxy)butanoyl]piperidine-4-carboxylate (PubChem CID 46763822) has the molecular formula C18H25NO5 and a molecular weight of 335.40 g/mol. Its IUPAC name is methyl 1-[2-(3-methoxyphenoxy)butanoyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-(3-methoxyphenoxy)butanoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46763822 |
| Molecular Formula | C18H25NO5 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | methyl 1-[2-(3-methoxyphenoxy)butanoyl]piperidine-4-carboxylate |
| SMILES | CCC(Oc1cccc(OC)c1)C(=O)N1CCC(C(=O)OC)CC1 |
| InChI | InChI=1S/C18H25NO5/c1-4-16(24-15-7-5-6-14(12-15)22-2)17(20)19-10-8-13(9-11-19)18(21)23-3/h5-7,12-13,16H,4,8-11H2,1-3H3 |
| InChIKey | WKARACPVSRLMIX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |