C16H22N2O4 — CID 99956942
4-[(2S)-2-(3-methoxyphenoxy)butanoyl]piperazine-1-carbaldehyde (PubChem CID 99956942) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 4-[(2S)-2-(3-methoxyphenoxy)butanoyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[(2S)-2-(3-methoxyphenoxy)butanoyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 99956942 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 4-[(2S)-2-(3-methoxyphenoxy)butanoyl]piperazine-1-carbaldehyde |
| SMILES | CC[C@H](Oc1cccc(OC)c1)C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C16H22N2O4/c1-3-15(22-14-6-4-5-13(11-14)21-2)16(20)18-9-7-17(12-19)8-10-18/h4-6,11-12,15H,3,7-10H2,1-2H3/t15-/m0/s1 |
| InChIKey | KYAZWZIGLIVIGG-HNNXBMFYSA-N |
| XLogP | 1.15 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|