C25H29N5O3 — CID 110093928
2-(3-methoxyphenoxy)-1-[4-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]butan-1-one (PubChem CID 110093928) has the molecular formula C25H29N5O3 and a molecular weight of 447.54 g/mol. Its IUPAC name is 2-(3-methoxyphenoxy)-1-[4-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]butan-1-one.
| Compound Name | 2-(3-methoxyphenoxy)-1-[4-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 110093928 |
| Molecular Formula | C25H29N5O3 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 2-(3-methoxyphenoxy)-1-[4-[6-(pyrazin-2-ylamino)-2-pyridinyl]piperidin-1-yl]butan-1-one |
| SMILES | CCC(Oc1cccc(OC)c1)C(=O)N1CCC(c2cccc(Nc3cnccn3)n2)CC1 |
| InChI | InChI=1S/C25H29N5O3/c1-3-22(33-20-7-4-6-19(16-20)32-2)25(31)30-14-10-18(11-15-30)21-8-5-9-23(28-21)29-24-17-26-12-13-27-24/h4-9,12-13,16-18,22H,3,10-11,14-15H2,1-2H3,(H,27,28,29) |
| InChIKey | LANIEVYEBFVIOB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |