C21H27NO3 — CID 6459062
ethyl 1-(3-naphthalen-2-yloxypropyl)piperidine-4-carboxylate (PubChem CID 6459062) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is ethyl 1-(3-naphthalen-2-yloxypropyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(3-naphthalen-2-yloxypropyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 6459062 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | ethyl 1-(3-naphthalen-2-yloxypropyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(CCCOc2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H27NO3/c1-2-24-21(23)18-10-13-22(14-11-18)12-5-15-25-20-9-8-17-6-3-4-7-19(17)16-20/h3-4,6-9,16,18H,2,5,10-15H2,1H3 |
| InChIKey | XBICVTDXJVTSOI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|