C22H29NO5 — CID 2888640
4-methyl-1-(4-naphthalen-2-yloxybutyl)piperidine;oxalic acid (PubChem CID 2888640) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-methyl-1-(4-naphthalen-2-yloxybutyl)piperidine;oxalic acid.
| Compound Name | 4-methyl-1-(4-naphthalen-2-yloxybutyl)piperidine;oxalic acid |
|---|---|
| PubChem CID | 2888640 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | 4-methyl-1-(4-naphthalen-2-yloxybutyl)piperidine;oxalic acid |
| SMILES | CC1CCN(CCCCOc2ccc3ccccc3c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H27NO.C2H2O4/c1-17-10-13-21(14-11-17)12-4-5-15-22-20-9-8-18-6-2-3-7-19(18)16-20;3-1(4)2(5)6/h2-3,6-9,16-17H,4-5,10-15H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XMYXWWDILIVKJS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|