C31H43NO2 — CID 24874230
(E)-3-[4-[10-(4-methylpiperidin-1-yl)decoxy]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 24874230) has the molecular formula C31H43NO2 and a molecular weight of 461.69 g/mol. Its IUPAC name is (E)-3-[4-[10-(4-methylpiperidin-1-yl)decoxy]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[4-[10-(4-methylpiperidin-1-yl)decoxy]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 24874230 |
| Molecular Formula | C31H43NO2 |
| Molecular Weight | 461.69 g/mol |
| Exact Mass | 461.33 |
| IUPAC Name | (E)-3-[4-[10-(4-methylpiperidin-1-yl)decoxy]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | CC1CCN(CCCCCCCCCCOc2ccc(/C=C/C(=O)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C31H43NO2/c1-27-21-24-32(25-22-27)23-11-6-4-2-3-5-7-12-26-34-30-18-15-28(16-19-30)17-20-31(33)29-13-9-8-10-14-29/h8-10,13-20,27H,2-7,11-12,21-26H2,1H3/b20-17+ |
| InChIKey | AZYMHVHTDBMCBK-LVZFUZTISA-N |
| XLogP | 7.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.69 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|