C31H34O2 — CID 22026801
(E)-3-[4-[8-(4-ethenylphenyl)octoxy]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 22026801) has the molecular formula C31H34O2 and a molecular weight of 438.61 g/mol. Its IUPAC name is (E)-3-[4-[8-(4-ethenylphenyl)octoxy]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[4-[8-(4-ethenylphenyl)octoxy]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 22026801 |
| Molecular Formula | C31H34O2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (E)-3-[4-[8-(4-ethenylphenyl)octoxy]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | C=Cc1ccc(CCCCCCCCOc2ccc(/C=C/C(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C31H34O2/c1-2-26-15-17-27(18-16-26)12-8-5-3-4-6-11-25-33-30-22-19-28(20-23-30)21-24-31(32)29-13-9-7-10-14-29/h2,7,9-10,13-24H,1,3-6,8,11-12,25H2/b24-21+ |
| InChIKey | VZOYMAPZUIVFCD-DARPEHSRSA-N |
| XLogP | 8.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|