C23H22N2O2 — CID 76760471
3-[4-[2-(3,5-diaminophenoxy)ethyl]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 76760471) has the molecular formula C23H22N2O2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-[4-[2-(3,5-diaminophenoxy)ethyl]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | 3-[4-[2-(3,5-diaminophenoxy)ethyl]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 76760471 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3-[4-[2-(3,5-diaminophenoxy)ethyl]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | Nc1cc(N)cc(OCCc2ccc(C=CC(=O)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C23H22N2O2/c24-20-14-21(25)16-22(15-20)27-13-12-18-8-6-17(7-9-18)10-11-23(26)19-4-2-1-3-5-19/h1-11,14-16H,12-13,24-25H2 |
| InChIKey | XPVKCRFGXKXPAH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|