C36H30N2O2 — CID 58289367
(E)-3-[4-[[4-[4-[2-(3,5-diaminophenyl)-2-oxoethyl]phenyl]phenyl]methyl]phenyl]-1-phenylprop-2-en-1-one (PubChem CID 58289367) has the molecular formula C36H30N2O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is (E)-3-[4-[[4-[4-[2-(3,5-diaminophenyl)-2-oxoethyl]phenyl]phenyl]methyl]phenyl]-1-phenylprop-2-en-1-one.
| Compound Name | (E)-3-[4-[[4-[4-[2-(3,5-diaminophenyl)-2-oxoethyl]phenyl]phenyl]methyl]phenyl]-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 58289367 |
| Molecular Formula | C36H30N2O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | (E)-3-[4-[[4-[4-[2-(3,5-diaminophenyl)-2-oxoethyl]phenyl]phenyl]methyl]phenyl]-1-phenylprop-2-en-1-one |
| SMILES | Nc1cc(N)cc(C(=O)Cc2ccc(-c3ccc(Cc4ccc(/C=C/C(=O)c5ccccc5)cc4)cc3)cc2)c1 |
| InChI | InChI=1S/C36H30N2O2/c37-33-22-32(23-34(38)24-33)36(40)21-28-12-17-30(18-13-28)29-15-10-27(11-16-29)20-26-8-6-25(7-9-26)14-19-35(39)31-4-2-1-3-5-31/h1-19,22-24H,20-21,37-38H2/b19-14+ |
| InChIKey | ZYUAEWXIZUGZAI-XMHGGMMESA-N |
| XLogP | 7.43 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|