C47H58N2O4 — CID 155536307
(E)-1-[4-[4-(4-benzylpiperidin-1-yl)butoxy]-2-hydroxyphenyl]-3-[4-[4-(4-benzylpiperidin-1-yl)butoxy]phenyl]prop-2-en-1-one (PubChem CID 155536307) has the molecular formula C47H58N2O4 and a molecular weight of 714.99 g/mol. Its IUPAC name is (E)-1-[4-[4-(4-benzylpiperidin-1-yl)butoxy]-2-hydroxyphenyl]-3-[4-[4-(4-benzylpiperidin-1-yl)butoxy]phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[4-(4-benzylpiperidin-1-yl)butoxy]-2-hydroxyphenyl]-3-[4-[4-(4-benzylpiperidin-1-yl)butoxy]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155536307 |
| Molecular Formula | C47H58N2O4 |
| Molecular Weight | 714.99 g/mol |
| Exact Mass | 714.44 |
| IUPAC Name | (E)-1-[4-[4-(4-benzylpiperidin-1-yl)butoxy]-2-hydroxyphenyl]-3-[4-[4-(4-benzylpiperidin-1-yl)butoxy]phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCCCCN2CCC(Cc3ccccc3)CC2)cc1)c1ccc(OCCCCN2CCC(Cc3ccccc3)CC2)cc1O |
| InChI | InChI=1S/C47H58N2O4/c50-46(45-21-20-44(37-47(45)51)53-34-10-8-28-49-31-25-42(26-32-49)36-40-13-5-2-6-14-40)22-17-38-15-18-43(19-16-38)52-33-9-7-27-48-29-23-41(24-30-48)35-39-11-3-1-4-12-39/h1-6,11-22,37,41-42,51H,7-10,23-36H2/b22-17+ |
| InChIKey | VWBXXMQJGHXSCF-OQKWZONESA-N |
| XLogP | 9.52 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.99 |
| LogP ≤ 5 | 9.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|