C29H38N2O4 — CID 155564123
(E)-1-[2-hydroxy-4-(2-piperidin-1-ylethoxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one (PubChem CID 155564123) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is (E)-1-[2-hydroxy-4-(2-piperidin-1-ylethoxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[2-hydroxy-4-(2-piperidin-1-ylethoxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155564123 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | (E)-1-[2-hydroxy-4-(2-piperidin-1-ylethoxy)phenyl]-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(OCCN2CCCCC2)cc1)c1ccc(OCCN2CCCCC2)cc1O |
| InChI | InChI=1S/C29H38N2O4/c32-28(27-13-12-26(23-29(27)33)35-22-20-31-17-5-2-6-18-31)14-9-24-7-10-25(11-8-24)34-21-19-30-15-3-1-4-16-30/h7-14,23,33H,1-6,15-22H2/b14-9+ |
| InChIKey | REQZKLNNKXMMAK-NTEUORMPSA-N |
| XLogP | 5.02 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|