C28H31NO5P2 — CID 59962426
(E)-1-(2-hydroxy-4-phosphanyloxyphenyl)-2-(4-phosphanyloxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one (PubChem CID 59962426) has the molecular formula C28H31NO5P2 and a molecular weight of 523.51 g/mol. Its IUPAC name is (E)-1-(2-hydroxy-4-phosphanyloxyphenyl)-2-(4-phosphanyloxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-(2-hydroxy-4-phosphanyloxyphenyl)-2-(4-phosphanyloxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 59962426 |
| Molecular Formula | C28H31NO5P2 |
| Molecular Weight | 523.51 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | (E)-1-(2-hydroxy-4-phosphanyloxyphenyl)-2-(4-phosphanyloxyphenyl)-3-[4-(2-piperidin-1-ylethoxy)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccc(OCCN2CCCCC2)cc1)c1ccc(OP)cc1)c1ccc(OP)cc1O |
| InChI | InChI=1S/C28H31NO5P2/c30-27-19-24(34-36)12-13-25(27)28(31)26(21-6-10-23(33-35)11-7-21)18-20-4-8-22(9-5-20)32-17-16-29-14-2-1-3-15-29/h4-13,18-19,30H,1-3,14-17,35-36H2/b26-18+ |
| InChIKey | UAPUYPIRNFGLIU-NLRVBDNBSA-N |
| XLogP | 6.02 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|