C27H26ClNO2 — CID 20838191
(E)-1-[3-chloro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-diphenylprop-2-en-1-one (PubChem CID 20838191) has the molecular formula C27H26ClNO2 and a molecular weight of 431.96 g/mol. Its IUPAC name is (E)-1-[3-chloro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-diphenylprop-2-en-1-one.
| Compound Name | (E)-1-[3-chloro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-diphenylprop-2-en-1-one |
|---|---|
| PubChem CID | 20838191 |
| Molecular Formula | C27H26ClNO2 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | (E)-1-[3-chloro-4-(2-pyrrolidin-1-ylethoxy)phenyl]-2,3-diphenylprop-2-en-1-one |
| SMILES | O=C(/C(=C/c1ccccc1)c1ccccc1)c1ccc(OCCN2CCCC2)c(Cl)c1 |
| InChI | InChI=1S/C27H26ClNO2/c28-25-20-23(13-14-26(25)31-18-17-29-15-7-8-16-29)27(30)24(22-11-5-2-6-12-22)19-21-9-3-1-4-10-21/h1-6,9-14,19-20H,7-8,15-18H2/b24-19+ |
| InChIKey | UOMYWWZDTWWOGO-LYBHJNIJSA-N |
| XLogP | 6.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|