C23H27NO4 — CID 20993089
(Z)-3-[4-methoxy-2-(2-piperidin-1-ylethoxy)phenyl]-2-phenylprop-2-enoic acid (PubChem CID 20993089) has the molecular formula C23H27NO4 and a molecular weight of 381.47 g/mol. Its IUPAC name is (Z)-3-[4-methoxy-2-(2-piperidin-1-ylethoxy)phenyl]-2-phenylprop-2-enoic acid.
| Compound Name | (Z)-3-[4-methoxy-2-(2-piperidin-1-ylethoxy)phenyl]-2-phenylprop-2-enoic acid |
|---|---|
| PubChem CID | 20993089 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | (Z)-3-[4-methoxy-2-(2-piperidin-1-ylethoxy)phenyl]-2-phenylprop-2-enoic acid |
| SMILES | COc1ccc(/C=C(\C(=O)O)c2ccccc2)c(OCCN2CCCCC2)c1 |
| InChI | InChI=1S/C23H27NO4/c1-27-20-11-10-19(16-21(23(25)26)18-8-4-2-5-9-18)22(17-20)28-15-14-24-12-6-3-7-13-24/h2,4-5,8-11,16-17H,3,6-7,12-15H2,1H3,(H,25,26)/b21-16- |
| InChIKey | SDTPJPZJHWWQNK-PGMHBOJBSA-N |
| XLogP | 4.19 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|