C21H24O6 — CID 20984861
(Z)-2-(3,4-dimethoxyphenyl)-3-(4-methoxy-2-propoxyphenyl)prop-2-enoic acid (PubChem CID 20984861) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is (Z)-2-(3,4-dimethoxyphenyl)-3-(4-methoxy-2-propoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(4-methoxy-2-propoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 20984861 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | (Z)-2-(3,4-dimethoxyphenyl)-3-(4-methoxy-2-propoxyphenyl)prop-2-enoic acid |
| SMILES | CCCOc1cc(OC)ccc1/C=C(\C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24O6/c1-5-10-27-19-13-16(24-2)8-6-15(19)11-17(21(22)23)14-7-9-18(25-3)20(12-14)26-4/h6-9,11-13H,5,10H2,1-4H3,(H,22,23)/b17-11- |
| InChIKey | UXKMHHGVXKNGHL-BOPFTXTBSA-N |
| XLogP | 4.13 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|