C18H17BrO5 — CID 20989568
(Z)-3-(5-bromo-2-methoxyphenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 20989568) has the molecular formula C18H17BrO5 and a molecular weight of 393.23 g/mol. Its IUPAC name is (Z)-3-(5-bromo-2-methoxyphenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (Z)-3-(5-bromo-2-methoxyphenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 20989568 |
| Molecular Formula | C18H17BrO5 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | (Z)-3-(5-bromo-2-methoxyphenyl)-2-(3,4-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1ccc(Br)cc1/C=C(\C(=O)O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C18H17BrO5/c1-22-15-7-5-13(19)8-12(15)9-14(18(20)21)11-4-6-16(23-2)17(10-11)24-3/h4-10H,1-3H3,(H,20,21)/b14-9- |
| InChIKey | GMHMNFFXJNODBQ-ZROIWOOFSA-N |
| XLogP | 4.10 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|