C21H25NO6 — CID 16637889
(E)-3-(2-amino-4-ethoxy-3-methoxyphenyl)-2-(3-ethoxy-4-methoxyphenyl)prop-2-enoic acid (PubChem CID 16637889) has the molecular formula C21H25NO6 and a molecular weight of 387.43 g/mol. Its IUPAC name is (E)-3-(2-amino-4-ethoxy-3-methoxyphenyl)-2-(3-ethoxy-4-methoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-amino-4-ethoxy-3-methoxyphenyl)-2-(3-ethoxy-4-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 16637889 |
| Molecular Formula | C21H25NO6 |
| Molecular Weight | 387.43 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (E)-3-(2-amino-4-ethoxy-3-methoxyphenyl)-2-(3-ethoxy-4-methoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1cc(/C(=C\c2ccc(OCC)c(OC)c2N)C(=O)O)ccc1OC |
| InChI | InChI=1S/C21H25NO6/c1-5-27-17-10-8-14(19(22)20(17)26-4)11-15(21(23)24)13-7-9-16(25-3)18(12-13)28-6-2/h7-12H,5-6,22H2,1-4H3,(H,23,24)/b15-11+ |
| InChIKey | PBGNSMOALDNEOH-RVDMUPIBSA-N |
| XLogP | 3.71 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.43 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|