C20H22O7 — CID 175352669
3-(4-ethoxy-3-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 175352669) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is 3-(4-ethoxy-3-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(4-ethoxy-3-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 175352669 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 3-(4-ethoxy-3-hydroxyphenyl)-2-(3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | CCOc1ccc(C=C(C(=O)O)c2cc(OC)c(OC)c(OC)c2)cc1O |
| InChI | InChI=1S/C20H22O7/c1-5-27-16-7-6-12(9-15(16)21)8-14(20(22)23)13-10-17(24-2)19(26-4)18(11-13)25-3/h6-11,21H,5H2,1-4H3,(H,22,23) |
| InChIKey | DTCJZZHCELCGHX-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|