C26H26O6 — CID 52941734
3-(3-hydroxy-4-methoxyphenyl)-2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 52941734) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 3-(3-hydroxy-4-methoxyphenyl)-2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(3-hydroxy-4-methoxyphenyl)-2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 52941734 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-(3-hydroxy-4-methoxyphenyl)-2-(4-methylphenyl)-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C=C(C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccc(C)cc2)cc1O |
| InChI | InChI=1S/C26H26O6/c1-16-6-9-18(10-7-16)20(12-17-8-11-22(29-2)21(27)13-17)25(28)19-14-23(30-3)26(32-5)24(15-19)31-4/h6-15,27H,1-5H3 |
| InChIKey | AVAPZOLICUVONG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|