C25H24O5 — CID 46226736
(E)-3-(4-methoxyphenyl)-2-phenyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 46226736) has the molecular formula C25H24O5 and a molecular weight of 404.46 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-2-phenyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-methoxyphenyl)-2-phenyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 46226736 |
| Molecular Formula | C25H24O5 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-2-phenyl-1-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C(/C(=O)c2cc(OC)c(OC)c(OC)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O5/c1-27-20-12-10-17(11-13-20)14-21(18-8-6-5-7-9-18)24(26)19-15-22(28-2)25(30-4)23(16-19)29-3/h5-16H,1-4H3/b21-14+ |
| InChIKey | QQAMAERTHSWIBP-KGENOOAVSA-N |
| XLogP | 5.14 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|