C44H35O8P — CID 57208190
bis[4-(2,3-diphenylprop-2-enoyl)-3-methoxyphenyl] hydrogen phosphate (PubChem CID 57208190) has the molecular formula C44H35O8P and a molecular weight of 722.73 g/mol. Its IUPAC name is bis[4-(2,3-diphenylprop-2-enoyl)-3-methoxyphenyl] hydrogen phosphate.
| Compound Name | bis[4-(2,3-diphenylprop-2-enoyl)-3-methoxyphenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 57208190 |
| Molecular Formula | C44H35O8P |
| Molecular Weight | 722.73 g/mol |
| Exact Mass | 722.21 |
| IUPAC Name | bis[4-(2,3-diphenylprop-2-enoyl)-3-methoxyphenyl] hydrogen phosphate |
| SMILES | COc1cc(OP(=O)(O)Oc2ccc(C(=O)C(=Cc3ccccc3)c3ccccc3)c(OC)c2)ccc1C(=O)C(=Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C44H35O8P/c1-49-41-29-35(23-25-37(41)43(45)39(33-19-11-5-12-20-33)27-31-15-7-3-8-16-31)51-53(47,48)52-36-24-26-38(42(30-36)50-2)44(46)40(34-21-13-6-14-22-34)28-32-17-9-4-10-18-32/h3-30H,1-2H3,(H,47,48) |
| InChIKey | LBNBBBGPJSJRNL-UHFFFAOYSA-N |
| XLogP | 10.11 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.73 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|