C23H23O8P — CID 21410784
[4-[2-oxo-2-(2,4,6-trimethoxyphenyl)ethyl]phenyl] phenyl hydrogen phosphate (PubChem CID 21410784) has the molecular formula C23H23O8P and a molecular weight of 458.40 g/mol. Its IUPAC name is [4-[2-oxo-2-(2,4,6-trimethoxyphenyl)ethyl]phenyl] phenyl hydrogen phosphate.
| Compound Name | [4-[2-oxo-2-(2,4,6-trimethoxyphenyl)ethyl]phenyl] phenyl hydrogen phosphate |
|---|---|
| PubChem CID | 21410784 |
| Molecular Formula | C23H23O8P |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | [4-[2-oxo-2-(2,4,6-trimethoxyphenyl)ethyl]phenyl] phenyl hydrogen phosphate |
| SMILES | COc1cc(OC)c(C(=O)Cc2ccc(OP(=O)(O)Oc3ccccc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H23O8P/c1-27-19-14-21(28-2)23(22(15-19)29-3)20(24)13-16-9-11-18(12-10-16)31-32(25,26)30-17-7-5-4-6-8-17/h4-12,14-15H,13H2,1-3H3,(H,25,26) |
| InChIKey | RVHQLMPMRRINRD-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|