C30H31O11P — CID 21410384
[4-[3-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]propanoyl]-3,5-di(propanoyloxy)phenyl] propanoate (PubChem CID 21410384) has the molecular formula C30H31O11P and a molecular weight of 598.54 g/mol. Its IUPAC name is [4-[3-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]propanoyl]-3,5-di(propanoyloxy)phenyl] propanoate.
| Compound Name | [4-[3-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]propanoyl]-3,5-di(propanoyloxy)phenyl] propanoate |
|---|---|
| PubChem CID | 21410384 |
| Molecular Formula | C30H31O11P |
| Molecular Weight | 598.54 g/mol |
| Exact Mass | 598.16 |
| IUPAC Name | [4-[3-[4-[hydroxy(phenoxy)phosphoryl]oxyphenyl]propanoyl]-3,5-di(propanoyloxy)phenyl] propanoate |
| SMILES | CCC(=O)Oc1cc(OC(=O)CC)c(C(=O)CCc2ccc(OP(=O)(O)Oc3ccccc3)cc2)c(OC(=O)CC)c1 |
| InChI | InChI=1S/C30H31O11P/c1-4-27(32)37-23-18-25(38-28(33)5-2)30(26(19-23)39-29(34)6-3)24(31)17-14-20-12-15-22(16-13-20)41-42(35,36)40-21-10-8-7-9-11-21/h7-13,15-16,18-19H,4-6,14,17H2,1-3H3,(H,35,36) |
| InChIKey | DRHSDMDCDFHCLJ-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.54 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|