C21H20NO5P — CID 21410591
(4-aminophenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate (PubChem CID 21410591) has the molecular formula C21H20NO5P and a molecular weight of 397.37 g/mol. Its IUPAC name is (4-aminophenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate.
| Compound Name | (4-aminophenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 21410591 |
| Molecular Formula | C21H20NO5P |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | (4-aminophenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate |
| SMILES | Nc1ccc(OP(=O)(O)Oc2ccc(CCC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C21H20NO5P/c22-18-9-13-20(14-10-18)27-28(24,25)26-19-11-6-16(7-12-19)8-15-21(23)17-4-2-1-3-5-17/h1-7,9-14H,8,15,22H2,(H,24,25) |
| InChIKey | PYRORSXZZHQBAH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|