About methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate
methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate (PubChem CID 90377055) has the molecular formula C11H15O5P
and a molecular weight of 258.21 g/mol. Its IUPAC name is methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate.
Molecular Properties
| Compound Name | methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate |
| PubChem CID | 90377055 |
| Molecular Formula | C11H15O5P |
| Molecular Weight | 258.21 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate |
| SMILES | COP(=O)(O)Oc1ccc(CCC(C)=O)cc1 |
| InChI | InChI=1S/C11H15O5P/c1-9(12)3-4-10-5-7-11(8-6-10)16-17(13,14)15-2/h5-8H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | MNAKBXHFULTPDO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.21 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate?
The IUPAC name of methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate (CID 90377055) is methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate.
What is the SMILES notation for methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate?
The canonical SMILES for methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate is COP(=O)(O)Oc1ccc(CCC(C)=O)cc1.
What is the InChIKey of methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate?
The InChIKey is MNAKBXHFULTPDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15O5P/c1-9(12)3-4-10-5-7-11(8-6-10)16-17(13,14)15-2/h5-8H,3-4H2,1-2H3,(H,13,14).
What are the key properties of methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate?
methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate has a molecular weight of 258.21 g/mol, XLogP of 2.33, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl [4-(3-oxobutyl)phenyl] hydrogen phosphate is sourced from PubChem (CID 90377055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).