C22H21O5P — CID 21410631
(4-methylphenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate (PubChem CID 21410631) has the molecular formula C22H21O5P and a molecular weight of 396.38 g/mol. Its IUPAC name is (4-methylphenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate.
| Compound Name | (4-methylphenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate |
|---|---|
| PubChem CID | 21410631 |
| Molecular Formula | C22H21O5P |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (4-methylphenyl) [4-(3-oxo-3-phenylpropyl)phenyl] hydrogen phosphate |
| SMILES | Cc1ccc(OP(=O)(O)Oc2ccc(CCC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C22H21O5P/c1-17-7-12-20(13-8-17)26-28(24,25)27-21-14-9-18(10-15-21)11-16-22(23)19-5-3-2-4-6-19/h2-10,12-15H,11,16H2,1H3,(H,24,25) |
| InChIKey | JMKLCQSQQFRWPG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|