C10H13O6P — CID 175308769
3-[hydroxy-(4-methylphenoxy)phosphoryl]oxypropanoic acid (PubChem CID 175308769) has the molecular formula C10H13O6P and a molecular weight of 260.18 g/mol. Its IUPAC name is 3-[hydroxy-(4-methylphenoxy)phosphoryl]oxypropanoic acid.
| Compound Name | 3-[hydroxy-(4-methylphenoxy)phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 175308769 |
| Molecular Formula | C10H13O6P |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-[hydroxy-(4-methylphenoxy)phosphoryl]oxypropanoic acid |
| SMILES | Cc1ccc(OP(=O)(O)OCCC(=O)O)cc1 |
| InChI | InChI=1S/C10H13O6P/c1-8-2-4-9(5-3-8)16-17(13,14)15-7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | SVALPUPUKYDRLX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|