C10H13O4P — CID 19011091
3-[hydroxy-(4-methylphenyl)phosphoryl]propanoic acid (PubChem CID 19011091) has the molecular formula C10H13O4P and a molecular weight of 228.18 g/mol. Its IUPAC name is 3-[hydroxy-(4-methylphenyl)phosphoryl]propanoic acid.
| Compound Name | 3-[hydroxy-(4-methylphenyl)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 19011091 |
| Molecular Formula | C10H13O4P |
| Molecular Weight | 228.18 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-[hydroxy-(4-methylphenyl)phosphoryl]propanoic acid |
| SMILES | Cc1ccc(P(=O)(O)CCC(=O)O)cc1 |
| InChI | InChI=1S/C10H13O4P/c1-8-2-4-9(5-3-8)15(13,14)7-6-10(11)12/h2-5H,6-7H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | ZJPIRJDIPFYVAW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.18 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|