C14H19O5P — CID 54487062
3-[2-carboxyethyl-(2,4-dimethylphenyl)phosphoryl]propanoic acid (PubChem CID 54487062) has the molecular formula C14H19O5P and a molecular weight of 298.28 g/mol. Its IUPAC name is 3-[2-carboxyethyl-(2,4-dimethylphenyl)phosphoryl]propanoic acid.
| Compound Name | 3-[2-carboxyethyl-(2,4-dimethylphenyl)phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 54487062 |
| Molecular Formula | C14H19O5P |
| Molecular Weight | 298.28 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-[2-carboxyethyl-(2,4-dimethylphenyl)phosphoryl]propanoic acid |
| SMILES | Cc1ccc(P(=O)(CCC(=O)O)CCC(=O)O)c(C)c1 |
| InChI | InChI=1S/C14H19O5P/c1-10-3-4-12(11(2)9-10)20(19,7-5-13(15)16)8-6-14(17)18/h3-4,9H,5-8H2,1-2H3,(H,15,16)(H,17,18) |
| InChIKey | XTBIWTAMGOZDPS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|