C29H38NO7P — CID 159468438
N-hydroxy-3-(4-methylphenyl)propanamide;2-(4-methylphenyl)ethylphosphonic acid;3-(4-methylphenyl)propanoic acid (PubChem CID 159468438) has the molecular formula C29H38NO7P and a molecular weight of 543.60 g/mol. Its IUPAC name is N-hydroxy-3-(4-methylphenyl)propanamide;2-(4-methylphenyl)ethylphosphonic acid;3-(4-methylphenyl)propanoic acid.
| Compound Name | N-hydroxy-3-(4-methylphenyl)propanamide;2-(4-methylphenyl)ethylphosphonic acid;3-(4-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 159468438 |
| Molecular Formula | C29H38NO7P |
| Molecular Weight | 543.60 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | N-hydroxy-3-(4-methylphenyl)propanamide;2-(4-methylphenyl)ethylphosphonic acid;3-(4-methylphenyl)propanoic acid |
| SMILES | Cc1ccc(CCC(=O)NO)cc1.Cc1ccc(CCC(=O)O)cc1.Cc1ccc(CCP(=O)(O)O)cc1 |
| InChI | InChI=1S/C10H13NO2.C10H12O2.C9H13O3P/c1-8-2-4-9(5-3-8)6-7-10(12)11-13;1-8-2-4-9(5-3-8)6-7-10(11)12;1-8-2-4-9(5-3-8)6-7-13(10,11)12/h2-5,13H,6-7H2,1H3,(H,11,12);2-5H,6-7H2,1H3,(H,11,12);2-5H,6-7H2,1H3,(H2,10,11,12) |
| InChIKey | LVMIXIYCIIIEEF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|