C32H27O10P — CID 21499373
4-[3-[3-[[3-[3-(4-carboxyphenyl)propanoyl]phenoxy]-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid (PubChem CID 21499373) has the molecular formula C32H27O10P and a molecular weight of 602.53 g/mol. Its IUPAC name is 4-[3-[3-[[3-[3-(4-carboxyphenyl)propanoyl]phenoxy]-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[3-[[3-[3-(4-carboxyphenyl)propanoyl]phenoxy]-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 21499373 |
| Molecular Formula | C32H27O10P |
| Molecular Weight | 602.53 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 4-[3-[3-[[3-[3-(4-carboxyphenyl)propanoyl]phenoxy]-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(=O)c2cccc(OP(=O)(O)Oc3cccc(C(=O)CCc4ccc(C(=O)O)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C32H27O10P/c33-29(17-11-21-7-13-23(14-8-21)31(35)36)25-3-1-5-27(19-25)41-43(39,40)42-28-6-2-4-26(20-28)30(34)18-12-22-9-15-24(16-10-22)32(37)38/h1-10,13-16,19-20H,11-12,17-18H2,(H,35,36)(H,37,38)(H,39,40) |
| InChIKey | UUHORWYBCXAICK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 164.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|