C23H21NNaO6P — CID 23708370
sodium [4-[3-(3-acetamidophenyl)-3-oxopropyl]phenyl] phenyl phosphate (PubChem CID 23708370) has the molecular formula C23H21NNaO6P and a molecular weight of 461.39 g/mol. Its IUPAC name is sodium [4-[3-(3-acetamidophenyl)-3-oxopropyl]phenyl] phenyl phosphate.
| Compound Name | sodium [4-[3-(3-acetamidophenyl)-3-oxopropyl]phenyl] phenyl phosphate |
|---|---|
| PubChem CID | 23708370 |
| Molecular Formula | C23H21NNaO6P |
| Molecular Weight | 461.39 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | sodium [4-[3-(3-acetamidophenyl)-3-oxopropyl]phenyl] phenyl phosphate |
| SMILES | CC(=O)Nc1cccc(C(=O)CCc2ccc(OP(=O)([O-])Oc3ccccc3)cc2)c1.[Na+] |
| InChI | InChI=1S/C23H22NO6P.Na/c1-17(25)24-20-7-5-6-19(16-20)23(26)15-12-18-10-13-22(14-11-18)30-31(27,28)29-21-8-3-2-4-9-21;/h2-11,13-14,16H,12,15H2,1H3,(H,24,25)(H,27,28);/q;+1/p-1 |
| InChIKey | XXYAJHJRDUZZEJ-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 104.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.39 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|