C22H18ClO7P — CID 21410363
4-[3-[3-[(3-chlorophenoxy)-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid (PubChem CID 21410363) has the molecular formula C22H18ClO7P and a molecular weight of 460.81 g/mol. Its IUPAC name is 4-[3-[3-[(3-chlorophenoxy)-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid.
| Compound Name | 4-[3-[3-[(3-chlorophenoxy)-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid |
|---|---|
| PubChem CID | 21410363 |
| Molecular Formula | C22H18ClO7P |
| Molecular Weight | 460.81 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | 4-[3-[3-[(3-chlorophenoxy)-hydroxyphosphoryl]oxyphenyl]-3-oxopropyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCC(=O)c2cccc(OP(=O)(O)Oc3cccc(Cl)c3)c2)cc1 |
| InChI | InChI=1S/C22H18ClO7P/c23-18-4-2-6-20(14-18)30-31(27,28)29-19-5-1-3-17(13-19)21(24)12-9-15-7-10-16(11-8-15)22(25)26/h1-8,10-11,13-14H,9,12H2,(H,25,26)(H,27,28) |
| InChIKey | YIZRZBYVOFHXJF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.81 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|