C24H24NaO8P — CID 23708476
sodium [3-[3-oxo-3-(2,4,6-trimethoxyphenyl)propyl]phenyl] phenyl phosphate (PubChem CID 23708476) has the molecular formula C24H24NaO8P and a molecular weight of 494.41 g/mol. Its IUPAC name is sodium [3-[3-oxo-3-(2,4,6-trimethoxyphenyl)propyl]phenyl] phenyl phosphate.
| Compound Name | sodium [3-[3-oxo-3-(2,4,6-trimethoxyphenyl)propyl]phenyl] phenyl phosphate |
|---|---|
| PubChem CID | 23708476 |
| Molecular Formula | C24H24NaO8P |
| Molecular Weight | 494.41 g/mol |
| Exact Mass | 494.11 |
| IUPAC Name | sodium [3-[3-oxo-3-(2,4,6-trimethoxyphenyl)propyl]phenyl] phenyl phosphate |
| SMILES | COc1cc(OC)c(C(=O)CCc2cccc(OP(=O)([O-])Oc3ccccc3)c2)c(OC)c1.[Na+] |
| InChI | InChI=1S/C24H25O8P.Na/c1-28-20-15-22(29-2)24(23(16-20)30-3)21(25)13-12-17-8-7-11-19(14-17)32-33(26,27)31-18-9-5-4-6-10-18;/h4-11,14-16H,12-13H2,1-3H3,(H,26,27);/q;+1/p-1 |
| InChIKey | SWQXEXMGDNKAQU-UHFFFAOYSA-M |
| XLogP | 1.46 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.41 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|