C29H26NaO7P — CID 23708356
sodium (2,6-dimethoxyphenyl) [3-(3-oxo-2,3-diphenylpropyl)phenyl] phosphate (PubChem CID 23708356) has the molecular formula C29H26NaO7P and a molecular weight of 540.48 g/mol. Its IUPAC name is sodium (2,6-dimethoxyphenyl) [3-(3-oxo-2,3-diphenylpropyl)phenyl] phosphate.
| Compound Name | sodium (2,6-dimethoxyphenyl) [3-(3-oxo-2,3-diphenylpropyl)phenyl] phosphate |
|---|---|
| PubChem CID | 23708356 |
| Molecular Formula | C29H26NaO7P |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | sodium (2,6-dimethoxyphenyl) [3-(3-oxo-2,3-diphenylpropyl)phenyl] phosphate |
| SMILES | COc1cccc(OC)c1OP(=O)([O-])Oc1cccc(CC(C(=O)c2ccccc2)c2ccccc2)c1.[Na+] |
| InChI | InChI=1S/C29H27O7P.Na/c1-33-26-17-10-18-27(34-2)29(26)36-37(31,32)35-24-16-9-11-21(19-24)20-25(22-12-5-3-6-13-22)28(30)23-14-7-4-8-15-23;/h3-19,25H,20H2,1-2H3,(H,31,32);/q;+1/p-1 |
| InChIKey | PVDSYXLYZJAKKK-UHFFFAOYSA-M |
| XLogP | 2.84 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|