(2S)-2,3-bis(3-methoxyphenyl)propanoic acid

C17H18O4 — CID 42051269

IUPAC(2S)-2,3-bis(3-methoxyphenyl)propanoic acid
SMILESCOc1cccc(C[C@H](C(=O)O)c2cccc(OC)c2)c1
InChIInChI=1S/C17H18O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-9,11,16H,10H2,1-2H3,(H,18,19)/t16-/m0/s1
InChIKeyZLDXFADKKNHPRT-INIZCTEOSA-N
MW286.33 g/mol
LogP3.11
Rot. Bonds6

About (2S)-2,3-bis(3-methoxyphenyl)propanoic acid

(2S)-2,3-bis(3-methoxyphenyl)propanoic acid (PubChem CID 42051269) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is (2S)-2,3-bis(3-methoxyphenyl)propanoic acid.

Molecular Properties

Compound Name(2S)-2,3-bis(3-methoxyphenyl)propanoic acid
PubChem CID42051269
Molecular FormulaC17H18O4
Molecular Weight286.33 g/mol
Exact Mass286.12
IUPAC Name(2S)-2,3-bis(3-methoxyphenyl)propanoic acid
SMILESCOc1cccc(C[C@H](C(=O)O)c2cccc(OC)c2)c1
InChIInChI=1S/C17H18O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-9,11,16H,10H2,1-2H3,(H,18,19)/t16-/m0/s1
InChIKeyZLDXFADKKNHPRT-INIZCTEOSA-N
XLogP3.11
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.33
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (2S)-2,3-bis(3-methoxyphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-2,3-bis(3-methoxyphenyl)propanoic acid?
The IUPAC name of (2S)-2,3-bis(3-methoxyphenyl)propanoic acid (CID 42051269) is (2S)-2,3-bis(3-methoxyphenyl)propanoic acid.
What is the SMILES notation for (2S)-2,3-bis(3-methoxyphenyl)propanoic acid?
The canonical SMILES for (2S)-2,3-bis(3-methoxyphenyl)propanoic acid is COc1cccc(C[C@H](C(=O)O)c2cccc(OC)c2)c1.
What is the InChIKey of (2S)-2,3-bis(3-methoxyphenyl)propanoic acid?
The InChIKey is ZLDXFADKKNHPRT-INIZCTEOSA-N. The full InChI is InChI=1S/C17H18O4/c1-20-14-7-3-5-12(9-14)10-16(17(18)19)13-6-4-8-15(11-13)21-2/h3-9,11,16H,10H2,1-2H3,(H,18,19)/t16-/m0/s1.
What are the key properties of (2S)-2,3-bis(3-methoxyphenyl)propanoic acid?
(2S)-2,3-bis(3-methoxyphenyl)propanoic acid has a molecular weight of 286.33 g/mol, XLogP of 3.11, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2,3-bis(3-methoxyphenyl)propanoic acid is sourced from PubChem (CID 42051269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).